C26H28N4O3 — CID 55786021
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 55786021) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55786021 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CC1CN(c2ccc(NC(=O)C=Cc3ccc(OCc4ccccn4)cc3)cn2)CC(C)O1 |
| InChI | InChI=1S/C26H28N4O3/c1-19-16-30(17-20(2)33-19)25-12-9-22(15-28-25)29-26(31)13-8-21-6-10-24(11-7-21)32-18-23-5-3-4-14-27-23/h3-15,19-20H,16-18H2,1-2H3,(H,29,31) |
| InChIKey | FTSMYAMYMOYLQQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|