C21H26FN3O3 — CID 55960129
N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(2-fluorophenoxy)butanamide (PubChem CID 55960129) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(2-fluorophenoxy)butanamide.
| Compound Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 55960129 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]-4-(2-fluorophenoxy)butanamide |
| SMILES | CC1CN(c2ccc(NC(=O)CCCOc3ccccc3F)cn2)CC(C)O1 |
| InChI | InChI=1S/C21H26FN3O3/c1-15-13-25(14-16(2)28-15)20-10-9-17(12-23-20)24-21(26)8-5-11-27-19-7-4-3-6-18(19)22/h3-4,6-7,9-10,12,15-16H,5,8,11,13-14H2,1-2H3,(H,24,26) |
| InChIKey | KVPWLPSJAZFTQJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|