C21H31N5O3S — CID 97024201
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]pentanamide (PubChem CID 97024201) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 97024201 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]pentanamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)CCCC[C@@H]3SC[C@@H]4NC(=O)N[C@@H]43)cn2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H31N5O3S/c1-13-10-26(11-14(2)29-13)18-8-7-15(9-22-18)23-19(27)6-4-3-5-17-20-16(12-30-17)24-21(28)25-20/h7-9,13-14,16-17,20H,3-6,10-12H2,1-2H3,(H,23,27)(H2,24,25,28)/t13-,14-,16+,17+,20+/m1/s1 |
| InChIKey | SKMWWCMEBPPFDR-ZNRGTERASA-N |
| XLogP | 2.36 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|