C17H22FN3O2S — CID 40873336
5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-fluoro-2-methylphenyl)pentanamide (PubChem CID 40873336) has the molecular formula C17H22FN3O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-fluoro-2-methylphenyl)pentanamide.
| Compound Name | 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-fluoro-2-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 40873336 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-fluoro-2-methylphenyl)pentanamide |
| SMILES | Cc1cc(F)ccc1NC(=O)CCCC[C@@H]1SC[C@H]2NC(=O)N[C@@H]12 |
| InChI | InChI=1S/C17H22FN3O2S/c1-10-8-11(18)6-7-12(10)19-15(22)5-3-2-4-14-16-13(9-24-14)20-17(23)21-16/h6-8,13-14,16H,2-5,9H2,1H3,(H,19,22)(H2,20,21,23)/t13-,14+,16-/m1/s1 |
| InChIKey | VWIJDMDKZYCIFX-IJEWVQPXSA-N |
| XLogP | 2.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|