C16H19ClFN3O2S — CID 100886693
5-[(3aR,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-chloro-2-fluorophenyl)pentanamide (PubChem CID 100886693) has the molecular formula C16H19ClFN3O2S and a molecular weight of 371.87 g/mol. Its IUPAC name is 5-[(3aR,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-chloro-2-fluorophenyl)pentanamide.
| Compound Name | 5-[(3aR,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-chloro-2-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 100886693 |
| Molecular Formula | C16H19ClFN3O2S |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-[(3aR,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-chloro-2-fluorophenyl)pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]21)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H19ClFN3O2S/c17-9-5-6-11(10(18)7-9)19-14(22)4-2-1-3-13-15-12(8-24-13)20-16(23)21-15/h5-7,12-13,15H,1-4,8H2,(H,19,22)(H2,20,21,23)/t12-,13-,15+/m0/s1 |
| InChIKey | IRYFYHVSOSIHJU-KCQAQPDRSA-N |
| XLogP | 3.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|