C18H22Cl2FN3O2S — CID 55936103
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]pentanamide (PubChem CID 55936103) has the molecular formula C18H22Cl2FN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 55936103 |
| Molecular Formula | C18H22Cl2FN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]pentanamide |
| SMILES | CC(NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2FN3O2S/c1-9(10-6-13(21)12(20)7-11(10)19)22-16(25)5-3-2-4-15-17-14(8-27-15)23-18(26)24-17/h6-7,9,14-15,17H,2-5,8H2,1H3,(H,22,25)(H2,23,24,26)/t9?,14-,15-,17-/m0/s1 |
| InChIKey | DBQGTHTVTKQXGC-JLQGLVGYSA-N |
| XLogP | 4.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|