C21H26F3N3O4S — CID 142031078
(2,3,6-trifluoro-5-methylphenyl) 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate (PubChem CID 142031078) has the molecular formula C21H26F3N3O4S and a molecular weight of 473.52 g/mol. Its IUPAC name is (2,3,6-trifluoro-5-methylphenyl) 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate.
| Compound Name | (2,3,6-trifluoro-5-methylphenyl) 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate |
|---|---|
| PubChem CID | 142031078 |
| Molecular Formula | C21H26F3N3O4S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (2,3,6-trifluoro-5-methylphenyl) 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate |
| SMILES | CCC(NC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)Oc1c(F)c(C)cc(F)c1F |
| InChI | InChI=1S/C21H26F3N3O4S/c1-3-12(20(29)31-19-16(23)10(2)8-11(22)17(19)24)25-15(28)7-5-4-6-14-18-13(9-32-14)26-21(30)27-18/h8,12-14,18H,3-7,9H2,1-2H3,(H,25,28)(H2,26,27,30) |
| InChIKey | JPILAUMKWDYHJY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|