C20H22F5N3O4S — CID 59814055
(2,3,4,5,6-pentafluorophenyl) 3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate (PubChem CID 59814055) has the molecular formula C20H22F5N3O4S and a molecular weight of 495.47 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate |
|---|---|
| PubChem CID | 59814055 |
| Molecular Formula | C20H22F5N3O4S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]butanoate |
| SMILES | CC(CC(=O)Oc1c(F)c(F)c(F)c(F)c1F)NC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C20H22F5N3O4S/c1-8(6-12(30)32-19-16(24)14(22)13(21)15(23)17(19)25)26-11(29)5-3-2-4-10-18-9(7-33-10)27-20(31)28-18/h8-10,18H,2-7H2,1H3,(H,26,29)(H2,27,28,31) |
| InChIKey | OAWATGCGILASGU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|