C16H27N3O4S — CID 119364194
(2R)-4-methyl-2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentanoic acid (PubChem CID 119364194) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is (2R)-4-methyl-2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119364194 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2R)-4-methyl-2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)O |
| InChI | InChI=1S/C16H27N3O4S/c1-9(2)7-10(15(21)22)17-13(20)6-4-3-5-12-14-11(8-24-12)18-16(23)19-14/h9-12,14H,3-8H2,1-2H3,(H,17,20)(H,21,22)(H2,18,19,23)/t10-,11?,12?,14?/m1/s1 |
| InChIKey | PNHKMSJDUCWFCB-YAJDGLSUSA-N |
| XLogP | 1.33 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|