C14H23N3O4S2 — CID 87391042
(2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-4-sulfanylbutanoic acid (PubChem CID 87391042) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-4-sulfanylbutanoic acid.
| Compound Name | (2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 87391042 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-4-sulfanylbutanoic acid |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)N[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/C14H23N3O4S2/c18-11(15-8(5-6-22)13(19)20)4-2-1-3-10-12-9(7-23-10)16-14(21)17-12/h8-10,12,22H,1-7H2,(H,15,18)(H,19,20)(H2,16,17,21)/t8-,9-,10-,12-/m0/s1 |
| InChIKey | FNHYOEAGMRTGML-GMOBBJLQSA-N |
| XLogP | 0.60 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|