C22H39N7O5S — CID 134824489
(2S)-2-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 134824489) has the molecular formula C22H39N7O5S and a molecular weight of 513.67 g/mol. Its IUPAC name is (2S)-2-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 134824489 |
| Molecular Formula | C22H39N7O5S |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (2S)-2-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C(=O)O |
| InChI | InChI=1S/C22H39N7O5S/c23-21(24)26-12-6-7-14(20(32)33)27-18(31)10-2-1-5-11-25-17(30)9-4-3-8-16-19-15(13-35-16)28-22(34)29-19/h14-16,19H,1-13H2,(H,25,30)(H,27,31)(H,32,33)(H4,23,24,26)(H2,28,29,34)/t14-,15-,16-,19-/m0/s1 |
| InChIKey | FPPAZWMKNNJZJW-FPXQBCRKSA-N |
| XLogP | 0.01 |
| TPSA | 201.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|