C20H34N4O7S3 — CID 4550488
3-methoxysulfonothioyl-2-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]propanoic acid (PubChem CID 4550488) has the molecular formula C20H34N4O7S3 and a molecular weight of 538.71 g/mol. Its IUPAC name is 3-methoxysulfonothioyl-2-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]propanoic acid.
| Compound Name | 3-methoxysulfonothioyl-2-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]propanoic acid |
|---|---|
| PubChem CID | 4550488 |
| Molecular Formula | C20H34N4O7S3 |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 3-methoxysulfonothioyl-2-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]propanoic acid |
| SMILES | COS(=O)(=S)CC(NC(=O)CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)O |
| InChI | InChI=1S/C20H34N4O7S3/c1-31-34(30,32)12-14(19(27)28)22-17(26)9-3-2-6-10-21-16(25)8-5-4-7-15-18-13(11-33-15)23-20(29)24-18/h13-15,18H,2-12H2,1H3,(H,21,25)(H,22,26)(H,27,28)(H2,23,24,29) |
| InChIKey | XQYMCIPEAYWHJD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|