C18H33N3O2S — CID 85258617
N-octyl-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 85258617) has the molecular formula C18H33N3O2S and a molecular weight of 355.55 g/mol. Its IUPAC name is N-octyl-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-octyl-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 85258617 |
| Molecular Formula | C18H33N3O2S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N-octyl-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | CCCCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C18H33N3O2S/c1-2-3-4-5-6-9-12-19-16(22)11-8-7-10-15-17-14(13-24-15)20-18(23)21-17/h14-15,17H,2-13H2,1H3,(H,19,22)(H2,20,21,23) |
| InChIKey | VYIYVLKFRPSFCT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|