C21H39N3O5S — CID 98590386
5-[(3aS,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[2-(2-butoxyethoxy)ethoxy]propyl]pentanamide (PubChem CID 98590386) has the molecular formula C21H39N3O5S and a molecular weight of 445.63 g/mol. Its IUPAC name is 5-[(3aS,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[2-(2-butoxyethoxy)ethoxy]propyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[2-(2-butoxyethoxy)ethoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 98590386 |
| Molecular Formula | C21H39N3O5S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 5-[(3aS,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[3-[2-(2-butoxyethoxy)ethoxy]propyl]pentanamide |
| SMILES | CCCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SC[C@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C21H39N3O5S/c1-2-3-10-27-12-14-29-15-13-28-11-6-9-22-19(25)8-5-4-7-18-20-17(16-30-18)23-21(26)24-20/h17-18,20H,2-16H2,1H3,(H,22,25)(H2,23,24,26)/t17-,18+,20+/m1/s1 |
| InChIKey | BYDMVSJSMATFEA-HBFSDRIKSA-N |
| XLogP | 2.07 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|