C26H48N4O6S — CID 142452024
4-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanamide (PubChem CID 142452024) has the molecular formula C26H48N4O6S and a molecular weight of 544.76 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanamide.
| Compound Name | 4-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 142452024 |
| Molecular Formula | C26H48N4O6S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 4-methyl-N-[3-[2-[2-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanamide |
| SMILES | CC(C)CCC(=O)NCCCOCCOCCOCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C26H48N4O6S/c1-20(2)9-10-24(32)28-12-6-14-35-16-18-36-17-15-34-13-5-11-27-23(31)8-4-3-7-22-25-21(19-37-22)29-26(33)30-25/h20-22,25H,3-19H2,1-2H3,(H,27,31)(H,28,32)(H2,29,30,33) |
| InChIKey | AMPGXRCEEYJYHC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|