C19H32N4O3S — CID 178169159
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[6-(prop-2-enoylamino)hexyl]pentanamide (PubChem CID 178169159) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[6-(prop-2-enoylamino)hexyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[6-(prop-2-enoylamino)hexyl]pentanamide |
|---|---|
| PubChem CID | 178169159 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[6-(prop-2-enoylamino)hexyl]pentanamide |
| SMILES | C=CC(=O)NCCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C19H32N4O3S/c1-2-16(24)20-11-7-3-4-8-12-21-17(25)10-6-5-9-15-18-14(13-27-15)22-19(26)23-18/h2,14-15,18H,1,3-13H2,(H,20,24)(H,21,25)(H2,22,23,26) |
| InChIKey | WCZBLSUJEFRNGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|