C16H29N3O3S2 — CID 163480338
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(6-sulfanyloxyhexyl)pentanamide (PubChem CID 163480338) has the molecular formula C16H29N3O3S2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(6-sulfanyloxyhexyl)pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(6-sulfanyloxyhexyl)pentanamide |
|---|---|
| PubChem CID | 163480338 |
| Molecular Formula | C16H29N3O3S2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(6-sulfanyloxyhexyl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCCCCCOS |
| InChI | InChI=1S/C16H29N3O3S2/c20-14(17-9-5-1-2-6-10-22-23)8-4-3-7-13-15-12(11-24-13)18-16(21)19-15/h12-13,15,23H,1-11H2,(H,17,20)(H2,18,19,21) |
| InChIKey | CDZRDIJTRQYXRP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|