C16H28N4O3S2 — CID 146568429
6-[5-[(6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-sulfanylhexanamide (PubChem CID 146568429) has the molecular formula C16H28N4O3S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 6-[5-[(6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-sulfanylhexanamide.
| Compound Name | 6-[5-[(6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-sulfanylhexanamide |
|---|---|
| PubChem CID | 146568429 |
| Molecular Formula | C16H28N4O3S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 6-[5-[(6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-sulfanylhexanamide |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SC[C@@H]2NC(=O)NC12)NS |
| InChI | InChI=1S/C16H28N4O3S2/c21-13(17-9-5-1-2-8-14(22)20-24)7-4-3-6-12-15-11(10-25-12)18-16(23)19-15/h11-12,15,24H,1-10H2,(H,17,21)(H,20,22)(H2,18,19,23)/t11-,12?,15?/m0/s1 |
| InChIKey | QGMSGKDERWQKGR-BZUNDVKYSA-N |
| XLogP | 1.35 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|