C22H39N3O5S — CID 54290269
N-(12,12-dihydroxy-6-oxododecyl)-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 54290269) has the molecular formula C22H39N3O5S and a molecular weight of 457.64 g/mol. Its IUPAC name is N-(12,12-dihydroxy-6-oxododecyl)-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-(12,12-dihydroxy-6-oxododecyl)-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 54290269 |
| Molecular Formula | C22H39N3O5S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-(12,12-dihydroxy-6-oxododecyl)-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)CCCCCC(O)O |
| InChI | InChI=1S/C22H39N3O5S/c26-16(9-3-1-5-13-20(28)29)10-4-2-8-14-23-19(27)12-7-6-11-18-21-17(15-31-18)24-22(30)25-21/h17-18,20-21,28-29H,1-15H2,(H,23,27)(H2,24,25,30) |
| InChIKey | CWNTVUCOJIBXGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|