C30H54N6O6S — CID 58697300
methyl 6-[[2-[6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-6-(methylamino)hexanoyl]amino]hexanoate (PubChem CID 58697300) has the molecular formula C30H54N6O6S and a molecular weight of 626.87 g/mol. Its IUPAC name is methyl 6-[[2-[6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-6-(methylamino)hexanoyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-[6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-6-(methylamino)hexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 58697300 |
| Molecular Formula | C30H54N6O6S |
| Molecular Weight | 626.87 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | methyl 6-[[2-[6-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]-6-(methylamino)hexanoyl]amino]hexanoate |
| SMILES | CNCCCCC(NC(=O)CCCCCNC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(=O)NCCCCCC(=O)OC |
| InChI | InChI=1S/C30H54N6O6S/c1-31-18-12-9-13-22(29(40)33-20-11-4-6-17-27(39)42-2)34-26(38)16-5-3-10-19-32-25(37)15-8-7-14-24-28-23(21-43-24)35-30(41)36-28/h22-24,28,31H,3-21H2,1-2H3,(H,32,37)(H,33,40)(H,34,38)(H2,35,36,41)/t22?,23-,24?,28-/m0/s1 |
| InChIKey | PSTSJJQCGYULQX-GOWKPAOZSA-N |
| XLogP | 2.11 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.87 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|