C14H25N3O5S2 — CID 157320363
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;(2S)-2-amino-4-sulfanylbutanoic acid (PubChem CID 157320363) has the molecular formula C14H25N3O5S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;(2S)-2-amino-4-sulfanylbutanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;(2S)-2-amino-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 157320363 |
| Molecular Formula | C14H25N3O5S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;(2S)-2-amino-4-sulfanylbutanoic acid |
| SMILES | N[C@@H](CCS)C(=O)O.O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H16N2O3S.C4H9NO2S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;5-3(1-2-8)4(6)7/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);3,8H,1-2,5H2,(H,6,7)/t6-,7-,9-;3-/m00/s1 |
| InChIKey | BEBZJMKNKLFZFY-KYLREGBFSA-N |
| XLogP | 0.51 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|