C20H32N7O6S2- — CID 175749247
bis(5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid);azide (PubChem CID 175749247) has the molecular formula C20H32N7O6S2- and a molecular weight of 530.65 g/mol. Its IUPAC name is bis(5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid);azide.
| Compound Name | bis(5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid);azide |
|---|---|
| PubChem CID | 175749247 |
| Molecular Formula | C20H32N7O6S2- |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | bis(5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid);azide |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.[N-]=[N+]=[N-] |
| InChI | InChI=1S/2C10H16N2O3S.N3/c2*13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;1-3-2/h2*6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);/q;;-1/t2*6-,7-,9-;/m00./s1 |
| InChIKey | GLGRHDPXNWPQMB-VXTDSVKWSA-N |
| XLogP | 2.46 |
| TPSA | 215.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|