C10H18N2O3PbS — CID 174156110
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;λ2-plumbane (PubChem CID 174156110) has the molecular formula C10H18N2O3PbS and a molecular weight of 453.53 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;λ2-plumbane.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;λ2-plumbane |
|---|---|
| PubChem CID | 174156110 |
| Molecular Formula | C10H18N2O3PbS |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;λ2-plumbane |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.[PbH2] |
| InChI | InChI=1S/C10H16N2O3S.Pb.2H/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;;;/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);;;/t6-,7-,9-;;;/m0.../s1 |
| InChIKey | MEDPDFRUIOCACW-CZSFMJCSSA-N |
| XLogP | -0.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|