C10H18ClN3O2S — CID 137321035
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide;hydrochloride (PubChem CID 137321035) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide;hydrochloride.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 137321035 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C10H17N3O2S.ClH/c11-8(14)4-2-1-3-7-9-6(5-16-7)12-10(15)13-9;/h6-7,9H,1-5H2,(H2,11,14)(H2,12,13,15);1H |
| InChIKey | GUHIYQNMPPZSAZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|