C12H23N3O2S — CID 142143398
ethane;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 142143398) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is ethane;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | ethane;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 142143398 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | ethane;5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | CC.NC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C10H17N3O2S.C2H6/c11-8(14)4-2-1-3-7-9-6(5-16-7)12-10(15)13-9;1-2/h6-7,9H,1-5H2,(H2,11,14)(H2,12,13,15);1-2H3 |
| InChIKey | DLWVDVDWEFCFAJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|