C16H29N3O5S — CID 141242953
5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-amino-4-methylpentanoic acid (PubChem CID 141242953) has the molecular formula C16H29N3O5S and a molecular weight of 375.49 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-amino-4-methylpentanoic acid.
| Compound Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-amino-4-methylpentanoic acid |
|---|---|
| PubChem CID | 141242953 |
| Molecular Formula | C16H29N3O5S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-amino-4-methylpentanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.O=C(O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C10H16N2O3S.C6H13NO2/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;1-4(2)3-5(7)6(8)9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);4-5H,3,7H2,1-2H3,(H,8,9)/t6-,7-,9-;/m1./s1 |
| InChIKey | IIZIJYABWUVCLO-JJVRHELESA-N |
| XLogP | 1.24 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|