C46H70N20O15S — CID 20611024
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;hexakis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid) (PubChem CID 20611024) has the molecular formula C46H70N20O15S and a molecular weight of 1175.26 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;hexakis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid).
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;hexakis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid) |
|---|---|
| PubChem CID | 20611024 |
| Molecular Formula | C46H70N20O15S |
| Molecular Weight | 1175.26 g/mol |
| Exact Mass | 1174.51 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;hexakis((2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid) |
| SMILES | N[C@@H](Cc1cnc[nH]1)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H16N2O3S.6C6H9N3O2/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;6*7-5(6(10)11)1-4-2-8-3-9-4/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);6*2-3,5H,1,7H2,(H,8,9)(H,10,11)/t6-,7-,9-;6*5-/m0000000/s1 |
| InChIKey | BHTKEDINICQXAD-KJGHZSEVSA-N |
| XLogP | -3.02 |
| TPSA | 630.43 Ų |
| H-Bond Donors | 21 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.26 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 21 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|