C16H28N4O4S — CID 22826394
(2S)-11-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2,6-diamino-7-oxoundecanoic acid (PubChem CID 22826394) has the molecular formula C16H28N4O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is (2S)-11-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2,6-diamino-7-oxoundecanoic acid.
| Compound Name | (2S)-11-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2,6-diamino-7-oxoundecanoic acid |
|---|---|
| PubChem CID | 22826394 |
| Molecular Formula | C16H28N4O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2S)-11-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2,6-diamino-7-oxoundecanoic acid |
| SMILES | NC(CCC[C@H](N)C(=O)O)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C16H28N4O4S/c17-9(4-3-5-10(18)15(22)23)12(21)6-1-2-7-13-14-11(8-25-13)19-16(24)20-14/h9-11,13-14H,1-8,17-18H2,(H,22,23)(H2,19,20,24)/t9?,10-,11-,13-,14-/m0/s1 |
| InChIKey | BKCUSHSOLYKRJK-UCESMXHPSA-N |
| XLogP | 0.19 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|