C13H21N3O5S2 — CID 91170133
(2R)-3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxysulfanyl]-2-aminopropanoic acid (PubChem CID 91170133) has the molecular formula C13H21N3O5S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2R)-3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxysulfanyl]-2-aminopropanoic acid.
| Compound Name | (2R)-3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxysulfanyl]-2-aminopropanoic acid |
|---|---|
| PubChem CID | 91170133 |
| Molecular Formula | C13H21N3O5S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (2R)-3-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyloxysulfanyl]-2-aminopropanoic acid |
| SMILES | N[C@@H](CSOC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C(=O)O |
| InChI | InChI=1S/C13H21N3O5S2/c14-7(12(18)19)5-23-21-10(17)4-2-1-3-9-11-8(6-22-9)15-13(20)16-11/h7-9,11H,1-6,14H2,(H,18,19)(H2,15,16,20)/t7-,8-,9-,11-/m0/s1 |
| InChIKey | ZXZJSQPCRUFORC-KBIXCLLPSA-N |
| XLogP | 0.32 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|