C10H17N2O3PS — CID 87266969
phosphanyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 87266969) has the molecular formula C10H17N2O3PS and a molecular weight of 276.30 g/mol. Its IUPAC name is phosphanyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | phosphanyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 87266969 |
| Molecular Formula | C10H17N2O3PS |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | phosphanyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)OP)N1 |
| InChI | InChI=1S/C10H17N2O3PS/c13-8(15-16)4-2-1-3-7-9-6(5-17-7)11-10(14)12-9/h6-7,9H,1-5,16H2,(H2,11,12,14)/t6-,7-,9-/m0/s1 |
| InChIKey | MZZFNFFFEPWYDI-ZKWXMUAHSA-N |
| XLogP | 1.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|