C15H26N2O3S — CID 158605835
tert-butyl 6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]hexanoate (PubChem CID 158605835) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is tert-butyl 6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]hexanoate.
| Compound Name | tert-butyl 6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]hexanoate |
|---|---|
| PubChem CID | 158605835 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl 6-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C15H26N2O3S/c1-15(2,3)20-12(18)8-6-4-5-7-11-13-10(9-21-11)16-14(19)17-13/h10-11,13H,4-9H2,1-3H3,(H2,16,17,19)/t10-,11-,13-/m0/s1 |
| InChIKey | YDEHTEQOGDYUTD-GVXVVHGQSA-N |
| XLogP | 2.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|