C23H42N2O6S2 — CID 171850311
tert-butyl 3-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentylsulfanyl]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 171850311) has the molecular formula C23H42N2O6S2 and a molecular weight of 506.73 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentylsulfanyl]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentylsulfanyl]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 171850311 |
| Molecular Formula | C23H42N2O6S2 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentylsulfanyl]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCSCCCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C23H42N2O6S2/c1-23(2,3)31-20(26)8-9-28-10-11-29-12-13-30-14-16-32-15-6-4-5-7-19-21-18(17-33-19)24-22(27)25-21/h18-19,21H,4-17H2,1-3H3,(H2,24,25,27)/t18-,19-,21-/m0/s1 |
| InChIKey | RZWHUHCNXOJFIR-ZJOUEHCJSA-N |
| XLogP | 3.23 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|