C20H36N4O4S — CID 73196449
tert-butyl N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentyl]carbamate (PubChem CID 73196449) has the molecular formula C20H36N4O4S and a molecular weight of 428.60 g/mol. Its IUPAC name is tert-butyl N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 73196449 |
| Molecular Formula | C20H36N4O4S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | tert-butyl N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C20H36N4O4S/c1-20(2,3)28-19(27)22-12-8-4-7-11-21-16(25)10-6-5-9-15-17-14(13-29-15)23-18(26)24-17/h14-15,17H,4-13H2,1-3H3,(H,21,25)(H,22,27)(H2,23,24,26) |
| InChIKey | QKFLRHKHYLQHHC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|