C27H49N5O5S — CID 54238794
tert-butyl N-[(2S)-1-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexylamino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 54238794) has the molecular formula C27H49N5O5S and a molecular weight of 555.79 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexylamino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexylamino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54238794 |
| Molecular Formula | C27H49N5O5S |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexylamino]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NCCCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C(C)(C)C |
| InChI | InChI=1S/C27H49N5O5S/c1-26(2,3)22(32-25(36)37-27(4,5)6)23(34)29-16-12-8-7-11-15-28-20(33)14-10-9-13-19-21-18(17-38-19)30-24(35)31-21/h18-19,21-22H,7-17H2,1-6H3,(H,28,33)(H,29,34)(H,32,36)(H2,30,31,35)/t18-,19-,21-,22+/m0/s1 |
| InChIKey | QOMKZIWGFXNNPV-BLKABHOGSA-N |
| XLogP | 3.44 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|