C21H39N3O4S — CID 149061919
(3aS,4S,6aR)-4-[8-[2-[2-(tert-butylamino)ethoxy]ethoxy]-5-oxooctyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 149061919) has the molecular formula C21H39N3O4S and a molecular weight of 429.63 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[8-[2-[2-(tert-butylamino)ethoxy]ethoxy]-5-oxooctyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[8-[2-[2-(tert-butylamino)ethoxy]ethoxy]-5-oxooctyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 149061919 |
| Molecular Formula | C21H39N3O4S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (3aS,4S,6aR)-4-[8-[2-[2-(tert-butylamino)ethoxy]ethoxy]-5-oxooctyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CC(C)(C)NCCOCCOCCCC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C21H39N3O4S/c1-21(2,3)22-10-12-28-14-13-27-11-6-8-16(25)7-4-5-9-18-19-17(15-29-18)23-20(26)24-19/h17-19,22H,4-15H2,1-3H3,(H2,23,24,26)/t17-,18-,19-/m0/s1 |
| InChIKey | QMAFROOIBVHYHN-FHWLQOOXSA-N |
| XLogP | 2.48 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|