C15H26N2O3S2 — CID 160527230
4-[5-oxo-8-(2-sulfanylethoxy)octyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 160527230) has the molecular formula C15H26N2O3S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 4-[5-oxo-8-(2-sulfanylethoxy)octyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[5-oxo-8-(2-sulfanylethoxy)octyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 160527230 |
| Molecular Formula | C15H26N2O3S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[5-oxo-8-(2-sulfanylethoxy)octyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)CCCOCCS |
| InChI | InChI=1S/C15H26N2O3S2/c18-11(5-3-7-20-8-9-21)4-1-2-6-13-14-12(10-22-13)16-15(19)17-14/h12-14,21H,1-10H2,(H2,16,17,19) |
| InChIKey | QVBIOYZFUZDBDZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|