C24H41N3O9S — CID 159305319
methyl 2-[2-[2-[[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate (PubChem CID 159305319) has the molecular formula C24H41N3O9S and a molecular weight of 547.67 g/mol. Its IUPAC name is methyl 2-[2-[2-[[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | methyl 2-[2-[2-[[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 159305319 |
| Molecular Formula | C24H41N3O9S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | methyl 2-[2-[2-[[2-[2-[8-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-4-oxooctoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetate |
| SMILES | COC(=O)COCCOCCNC(=O)COCCOCCCC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C24H41N3O9S/c1-32-22(30)16-36-14-12-34-10-8-25-21(29)15-35-13-11-33-9-4-6-18(28)5-2-3-7-20-23-19(17-37-20)26-24(31)27-23/h19-20,23H,2-17H2,1H3,(H,25,29)(H2,26,27,31)/t19-,20-,23-/m0/s1 |
| InChIKey | FYNRQJZBPRBTHG-JTAQYXEDSA-N |
| XLogP | 0.42 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|