C29H30N2O3S2 — CID 140802201
tritylsulfanyl 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 140802201) has the molecular formula C29H30N2O3S2 and a molecular weight of 518.70 g/mol. Its IUPAC name is tritylsulfanyl 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | tritylsulfanyl 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 140802201 |
| Molecular Formula | C29H30N2O3S2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | tritylsulfanyl 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@@H]2[C@@H](CS[C@@H]2CCCCC(=O)OSC(c2ccccc2)(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C29H30N2O3S2/c32-26(19-11-10-18-25-27-24(20-35-25)30-28(33)31-27)34-36-29(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-9,12-17,24-25,27H,10-11,18-20H2,(H2,30,31,33)/t24-,25-,27-/m1/s1 |
| InChIKey | UTSXUJCGEZORRO-RGSZASNESA-N |
| XLogP | 5.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|