C17H27N5O6S — CID 71545093
2-[[(2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-5-amino-5-oxopentanoyl]amino]acetic acid (PubChem CID 71545093) has the molecular formula C17H27N5O6S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[[(2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-5-amino-5-oxopentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-5-amino-5-oxopentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71545093 |
| Molecular Formula | C17H27N5O6S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[[(2S)-2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-5-amino-5-oxopentanoyl]amino]acetic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H27N5O6S/c18-12(23)6-5-9(16(27)19-7-14(25)26)20-13(24)4-2-1-3-11-15-10(8-29-11)21-17(28)22-15/h9-11,15H,1-8H2,(H2,18,23)(H,19,27)(H,20,24)(H,25,26)(H2,21,22,28)/t9-,10-,11-,15-/m0/s1 |
| InChIKey | MJRCZUBJMRMKHJ-VEABSNGSSA-N |
| XLogP | -1.34 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|