C15H22Cl3FN2O — CID 119686390
7-amino-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]heptanamide;hydrochloride (PubChem CID 119686390) has the molecular formula C15H22Cl3FN2O and a molecular weight of 371.71 g/mol. Its IUPAC name is 7-amino-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119686390 |
| Molecular Formula | C15H22Cl3FN2O |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 7-amino-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]heptanamide;hydrochloride |
| SMILES | CC(NC(=O)CCCCCCN)c1cc(F)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C15H21Cl2FN2O.ClH/c1-10(11-8-14(18)13(17)9-12(11)16)20-15(21)6-4-2-3-5-7-19;/h8-10H,2-7,19H2,1H3,(H,20,21);1H |
| InChIKey | XXTVRVMDGHZLIF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|