C21H22Cl2FNO4 — CID 55738513
4-(4-acetyl-2-methoxyphenoxy)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]butanamide (PubChem CID 55738513) has the molecular formula C21H22Cl2FNO4 and a molecular weight of 442.31 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 55738513 |
| Molecular Formula | C21H22Cl2FNO4 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H22Cl2FNO4/c1-12(15-10-18(24)17(23)11-16(15)22)25-21(27)5-4-8-29-19-7-6-14(13(2)26)9-20(19)28-3/h6-7,9-12H,4-5,8H2,1-3H3,(H,25,27) |
| InChIKey | YODBLINALDZGMV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|