C20H30N2O5 — CID 55750497
2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N,4-dimethylpentanamide (PubChem CID 55750497) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N,4-dimethylpentanamide.
| Compound Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 55750497 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)CCCOc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C20H30N2O5/c1-13(2)11-16(20(25)21-4)22-19(24)7-6-10-27-17-9-8-15(14(3)23)12-18(17)26-5/h8-9,12-13,16H,6-7,10-11H2,1-5H3,(H,21,25)(H,22,24) |
| InChIKey | KSXQQHWYOAWNEF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|