C24H25NO5 — CID 55759778
4-(4-acetyl-2-methoxyphenoxy)-N-[furan-2-yl(phenyl)methyl]butanamide (PubChem CID 55759778) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[furan-2-yl(phenyl)methyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[furan-2-yl(phenyl)methyl]butanamide |
|---|---|
| PubChem CID | 55759778 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[furan-2-yl(phenyl)methyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NC(c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C24H25NO5/c1-17(26)19-12-13-20(22(16-19)28-2)29-15-7-11-23(27)25-24(21-10-6-14-30-21)18-8-4-3-5-9-18/h3-6,8-10,12-14,16,24H,7,11,15H2,1-2H3,(H,25,27) |
| InChIKey | YZBBVHVLWXIRCT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|