C19H20Cl2N2O4 — CID 55789835
4-(4-acetyl-2-methoxyphenoxy)-N-(4-amino-3,5-dichlorophenyl)butanamide (PubChem CID 55789835) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-(4-amino-3,5-dichlorophenyl)butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-(4-amino-3,5-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 55789835 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-(4-amino-3,5-dichlorophenyl)butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-11(24)12-5-6-16(17(8-12)26-2)27-7-3-4-18(25)23-13-9-14(20)19(22)15(21)10-13/h5-6,8-10H,3-4,7,22H2,1-2H3,(H,23,25) |
| InChIKey | BEMTVNFOEIXIQD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|