C21H23Cl2NO4 — CID 60566414
4-(4-acetyl-2-methoxyphenoxy)-N-[2-(2,6-dichlorophenyl)ethyl]butanamide (PubChem CID 60566414) has the molecular formula C21H23Cl2NO4 and a molecular weight of 424.32 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[2-(2,6-dichlorophenyl)ethyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[2-(2,6-dichlorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 60566414 |
| Molecular Formula | C21H23Cl2NO4 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[2-(2,6-dichlorophenyl)ethyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H23Cl2NO4/c1-14(25)15-8-9-19(20(13-15)27-2)28-12-4-7-21(26)24-11-10-16-17(22)5-3-6-18(16)23/h3,5-6,8-9,13H,4,7,10-12H2,1-2H3,(H,24,26) |
| InChIKey | JPHHUMMATOQYCR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|