C23H36N2O4 — CID 55743530
4-(4-acetyl-2-methoxyphenoxy)-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide (PubChem CID 55743530) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 55743530 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NCCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C23H36N2O4/c1-18-10-14-25(15-11-18)13-5-4-12-24-23(27)7-6-16-29-21-9-8-20(19(2)26)17-22(21)28-3/h8-9,17-18H,4-7,10-16H2,1-3H3,(H,24,27) |
| InChIKey | HEMIIJWUYPVDCX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|