C18H27ClN2O4 — CID 119388425
4-(4-acetyl-2-methoxyphenoxy)-N-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119388425) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119388425 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NC1CCNCC1.Cl |
| InChI | InChI=1S/C18H26N2O4.ClH/c1-13(21)14-5-6-16(17(12-14)23-2)24-11-3-4-18(22)20-15-7-9-19-10-8-15;/h5-6,12,15,19H,3-4,7-11H2,1-2H3,(H,20,22);1H |
| InChIKey | CIRKPWPBOJBNIQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|