C19H30N2O6S — CID 55749212
4-(4-acetyl-2-methoxyphenoxy)-N-[3-[ethylsulfonyl(methyl)amino]propyl]butanamide (PubChem CID 55749212) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[3-[ethylsulfonyl(methyl)amino]propyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[3-[ethylsulfonyl(methyl)amino]propyl]butanamide |
|---|---|
| PubChem CID | 55749212 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[3-[ethylsulfonyl(methyl)amino]propyl]butanamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)CCCOc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C19H30N2O6S/c1-5-28(24,25)21(3)12-7-11-20-19(23)8-6-13-27-17-10-9-16(15(2)22)14-18(17)26-4/h9-10,14H,5-8,11-13H2,1-4H3,(H,20,23) |
| InChIKey | JXENUBSQEYYIFK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|