C23H30N2O7S — CID 55791807
4-(4-acetyl-2-methoxyphenoxy)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]butanamide (PubChem CID 55791807) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]butanamide |
|---|---|
| PubChem CID | 55791807 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]butanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)CCCOc2ccc(C(C)=O)cc2OC)c1 |
| InChI | InChI=1S/C23H30N2O7S/c1-5-25(6-2)33(29,30)18-10-11-20(27)19(15-18)24-23(28)8-7-13-32-21-12-9-17(16(3)26)14-22(21)31-4/h9-12,14-15,27H,5-8,13H2,1-4H3,(H,24,28) |
| InChIKey | KSJQEBIEPCHBCK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|