C27H38N2O6S — CID 19185169
(E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19185169) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19185169 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2OC)cc1OC |
| InChI | InChI=1S/C27H38N2O6S/c1-6-9-10-11-18-35-25-15-12-21(19-26(25)34-5)13-17-27(30)28-23-20-22(14-16-24(23)33-4)36(31,32)29(7-2)8-3/h12-17,19-20H,6-11,18H2,1-5H3,(H,28,30)/b17-13+ |
| InChIKey | JXLGMXBOOXICLM-GHRIWEEISA-N |
| XLogP | 5.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|